EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H23N5O3 |
| Net Charge | 0 |
| Average Mass | 273.337 |
| Monoisotopic Mass | 273.18009 |
| SMILES | CC(C)[C@H](N)C(=O)N[C@@H](CCCNC(=N)N)C(=O)O |
| InChI | InChI=1S/C11H23N5O3/c1-6(2)8(12)9(17)16-7(10(18)19)4-3-5-15-11(13)14/h6-8H,3-5,12H2,1-2H3,(H,16,17)(H,18,19)(H4,13,14,15)/t7-,8-/m0/s1 |
| InChIKey | IBIDRSSEHFLGSD-YUMQZZPRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Val-Arg (CHEBI:73711) has functional parent L-arginine (CHEBI:16467) |
| Val-Arg (CHEBI:73711) has functional parent L-valine (CHEBI:16414) |
| Val-Arg (CHEBI:73711) has role metabolite (CHEBI:25212) |
| Val-Arg (CHEBI:73711) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-valyl-L-arginine |
| Synonyms | Source |
|---|---|
| L-Val-L-Arg | ChEBI |
| valylarginine | ChEBI |
| V-R | ChEBI |
| VR | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029121 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5344668 | Reaxys |