EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17N3O3 |
| Net Charge | 0 |
| Average Mass | 275.308 |
| Monoisotopic Mass | 275.12699 |
| SMILES | C[C@H](NC(=O)[C@@H](N)Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C14H17N3O3/c1-8(14(19)20)17-13(18)11(15)6-9-7-16-12-5-3-2-4-10(9)12/h2-5,7-8,11,16H,6,15H2,1H3,(H,17,18)(H,19,20)/t8-,11-/m0/s1 |
| InChIKey | OHGNSVACHBZKSS-KWQFWETISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trp-Ala (CHEBI:73710) has functional parent L-alanine (CHEBI:16977) |
| Trp-Ala (CHEBI:73710) has functional parent L-tryptophan (CHEBI:16828) |
| Trp-Ala (CHEBI:73710) has role metabolite (CHEBI:25212) |
| Trp-Ala (CHEBI:73710) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-tryptophyl-L-alanine |
| Synonyms | Source |
|---|---|
| WA | ChEBI |
| L-Trp-L-Ala | ChEBI |
| W-A | ChEBI |
| tryptophylalanine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029076 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5763019 | Reaxys |