EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C37H70N2O12 |
| Net Charge | 0 |
| Average Mass | 734.969 |
| Monoisotopic Mass | 734.49288 |
| SMILES | CC[C@H]1OC(=O)[C@H](C)[C@@H](O[C@H]2C[C@@](C)(OC)[C@@H](O)[C@H](C)O2)[C@H](C)[C@@H](O[C@@H]2O[C@H](C)C[C@H](N(C)C)[C@H]2O)[C@](C)(O)C[C@@H](C)[C@H](N)[C@H](C)[C@@H](O)[C@]1(C)O |
| InChI | InChI=1S/C37H70N2O12/c1-14-25-37(10,45)30(41)20(4)27(38)18(2)16-35(8,44)32(51-34-28(40)24(39(11)12)15-19(3)47-34)21(5)29(22(6)33(43)49-25)50-26-17-36(9,46-13)31(42)23(7)48-26/h18-32,34,40-42,44-45H,14-17,38H2,1-13H3/t18-,19-,20+,21+,22-,23+,24+,25-,26+,27+,28-,29+,30-,31+,32-,34+,35-,36-,37-/m1/s1 |
| InChIKey | XCLJRCAJSCMIND-JCTYMORFSA-N |
| Roles Classification |
|---|
| Biological Role: | antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (9S)-erythromycyclamine (CHEBI:73708) is a macrolide antibiotic (CHEBI:25105) |
| Synonyms | Source |
|---|---|
| 9-amino-9-deoxoerythromycin | ChemIDplus |
| 9-epierythromycylamine | ChemIDplus |
| (9S)-9-amino-9-deoxoerythromycin | ChemIDplus |
| BRN 4241492 | ChemIDplus |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4241492 | Reaxys |
| CAS:26116-56-3 | ChemIDplus |