EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H20N2O4 |
| Net Charge | 0 |
| Average Mass | 280.324 |
| Monoisotopic Mass | 280.14231 |
| SMILES | CC(C)[C@H](N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C14H20N2O4/c1-8(2)12(15)13(18)16-11(14(19)20)7-9-3-5-10(17)6-4-9/h3-6,8,11-12,17H,7,15H2,1-2H3,(H,16,18)(H,19,20)/t11-,12-/m0/s1 |
| InChIKey | VEYJKJORLPYVLO-RYUDHWBXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Val-Tyr (CHEBI:73703) has functional parent L-tyrosine (CHEBI:17895) |
| Val-Tyr (CHEBI:73703) has functional parent L-valine (CHEBI:16414) |
| Val-Tyr (CHEBI:73703) has role metabolite (CHEBI:25212) |
| Val-Tyr (CHEBI:73703) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-valyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| V-Y | ChEBI |
| L-Val-L-Tyr | ChEBI |
| VY | ChEBI |
| valyltyrosine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029139 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2663974 | Reaxys |