EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17N3O4 |
| Net Charge | 0 |
| Average Mass | 291.307 |
| Monoisotopic Mass | 291.12191 |
| SMILES | N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C14H17N3O4/c15-10(13(19)17-12(7-18)14(20)21)5-8-6-16-11-4-2-1-3-9(8)11/h1-4,6,10,12,16,18H,5,7,15H2,(H,17,19)(H,20,21)/t10-,12-/m0/s1 |
| InChIKey | MYVYPSWUSKCCHG-JQWIXIFHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trp-Ser (CHEBI:73694) has functional parent L-serine (CHEBI:17115) |
| Trp-Ser (CHEBI:73694) has functional parent L-tryptophan (CHEBI:16828) |
| Trp-Ser (CHEBI:73694) has role metabolite (CHEBI:25212) |
| Trp-Ser (CHEBI:73694) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-tryptophyl-L-serine |
| Synonyms | Source |
|---|---|
| L-Trp-L-Ser | ChEBI |
| tryptophylserine | ChEBI |
| W-S | ChEBI |
| WS | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029092 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7223046 | Reaxys |