EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:73689 - methyl isobutyrate
| Formula | C5H10O2 |
| Net Charge | 0 |
| Average Mass | 102.133 |
| Monoisotopic Mass | 102.06808 |
| SMILES | COC(=O)C(C)C |
| InChI | InChI=1S/C5H10O2/c1-4(2)5(6)7-3/h4H,1-3H3 |
| InChIKey | BHIWKHZACMWKOJ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| methyl isobutyrate (CHEBI:73689) has functional parent isobutyric acid (CHEBI:16135) |
| methyl isobutyrate (CHEBI:73689) has role metabolite (CHEBI:25212) |
| methyl isobutyrate (CHEBI:73689) is a fatty acid methyl ester (CHEBI:4986) |
| IUPAC Name |
|---|
| methyl 2-methylpropanoate |
| Citations |
|---|