EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H22N4O6 |
| Net Charge | 0 |
| Average Mass | 390.396 |
| Monoisotopic Mass | 390.15393 |
| SMILES | C[C@H](NC(=O)[C@@H](N)Cc1cnc2ccccc12)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C18H22N4O6/c1-9(16(25)22-14(18(27)28)7-15(23)24)21-17(26)12(19)6-10-8-20-13-5-3-2-4-11(10)13/h2-5,8-9,12,14,20H,6-7,19H2,1H3,(H,21,26)(H,22,25)(H,23,24)(H,27,28)/t9-,12-,14-/m0/s1 |
| InChIKey | OETOOJXFNSEYHQ-WFBYXXMGSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Trp-Ala-Asp (CHEBI:73671) has functional parent L-alanine (CHEBI:16977) |
| Trp-Ala-Asp (CHEBI:73671) has functional parent L-aspartic acid (CHEBI:17053) |
| Trp-Ala-Asp (CHEBI:73671) has functional parent L-tryptophan (CHEBI:16828) |
| Trp-Ala-Asp (CHEBI:73671) has role metabolite (CHEBI:25212) |
| Trp-Ala-Asp (CHEBI:73671) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-tryptophyl-L-alanyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| L-Trp-L-Ala-L-Asp | ChEBI |
| W-A-D | ChEBI |
| WAD | ChEBI |