EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H15N3O6S |
| Net Charge | 0 |
| Average Mass | 353.356 |
| Monoisotopic Mass | 353.06816 |
| SMILES | N[C@@H](CSC1=CC(=O)C(=O)c2ncc(C[C@H](N)C(=O)O)c21)C(=O)O |
| InChI | InChI=1S/C14H15N3O6S/c15-6(13(20)21)1-5-3-17-11-10(5)9(2-8(18)12(11)19)24-4-7(16)14(22)23/h2-3,6-7,17H,1,4,15-16H2,(H,20,21)(H,22,23)/t6-,7-/m0/s1 |
| InChIKey | XSFUAHVXCRYKEI-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| cysteine tryptophylquinone (CHEBI:73670) is a L-cysteine thioether (CHEBI:27532) |
| cysteine tryptophylquinone (CHEBI:73670) is a L-tryptophan derivative (CHEBI:47994) |
| cysteine tryptophylquinone (CHEBI:73670) is a orthoquinones (CHEBI:25622) |
| Incoming Relation(s) |
| cysteine tryptophylquinone residue (CHEBI:20252) is substituent group from cysteine tryptophylquinone (CHEBI:73670) |
| IUPAC Name |
|---|
| S-{3-[(2S)-2-amino-2-carboxyethyl]-6,7-dioxo-6,7-dihydro-1H-indol-4-yl}-L-cysteine |
| Synonym | Source |
|---|---|
| CTQ | MetaCyc |
| Manual Xrefs | Databases |
|---|---|
| CPD-12470 | MetaCyc |
| Citations |
|---|