EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H21N3O6 |
| Net Charge | 0 |
| Average Mass | 339.348 |
| Monoisotopic Mass | 339.14304 |
| SMILES | N[C@@H](CCCCNC1=CC(=O)C(=O)C=C1C[C@H](N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C15H21N3O6/c16-9(14(21)22)3-1-2-4-18-11-7-13(20)12(19)6-8(11)5-10(17)15(23)24/h6-7,9-10,18H,1-5,16-17H2,(H,21,22)(H,23,24)/t9-,10-/m0/s1 |
| InChIKey | ATSBFAGKFWTGFG-UWVGGRQHSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5'-(N6-L-lysine)-L-tyrosylquinone (CHEBI:73669) is a L-lysine derivative (CHEBI:25095) |
| 5'-(N6-L-lysine)-L-tyrosylquinone (CHEBI:73669) is a L-tyrosine derivative (CHEBI:27177) |
| 5'-(N6-L-lysine)-L-tyrosylquinone (CHEBI:73669) is a 1,2-benzoquinones (CHEBI:132123) |
| 5'-(N6-L-lysine)-L-tyrosylquinone (CHEBI:73669) is a non-proteinogenic L-α-amino acid (CHEBI:83822) |
| Incoming Relation(s) |
| 5'-(N6-L-lysine)-L-tyrosylquinone residue (CHEBI:20489) is substituent group from 5'-(N6-L-lysine)-L-tyrosylquinone (CHEBI:73669) |
| IUPAC Name |
|---|
| N6-{6-[(2S)-2-amino-2-carboxyethyl]-3,4-dioxocyclohexa-1,5-dien-1-yl}-L-lysine |
| Synonyms | Source |
|---|---|
| lysyl oxidase cofactor | ChEBI |
| lysine tyrosylquinone | MetaCyc |
| LTQ | MetaCyc |
| 1-[(S)-5-amino-5-carboxypentyl]amino-2-[(S)-2-amino-2-carboxyethyl]-2,6-cyclohexadien-4,5-dione | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| CPD-12143 | MetaCyc |
| Citations |
|---|