EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O5 |
| Net Charge | 0 |
| Average Mass | 282.296 |
| Monoisotopic Mass | 282.12157 |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C13H18N2O5/c1-7(16)11(14)12(18)15-10(13(19)20)6-8-2-4-9(17)5-3-8/h2-5,7,10-11,16-17H,6,14H2,1H3,(H,15,18)(H,19,20)/t7-,10+,11+/m1/s1 |
| InChIKey | WCRFXRIWBFRZBR-GGVZMXCHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Tyr (CHEBI:73667) has functional parent L-threonine (CHEBI:16857) |
| Thr-Tyr (CHEBI:73667) has functional parent L-tyrosine (CHEBI:17895) |
| Thr-Tyr (CHEBI:73667) has role metabolite (CHEBI:25212) |
| Thr-Tyr (CHEBI:73667) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-threonyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| L-Thr-L-Tyr | ChEBI |
| T-Y | ChEBI |
| TY | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029073 | HMDB |