EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H19N3O4 |
| Net Charge | 0 |
| Average Mass | 305.334 |
| Monoisotopic Mass | 305.13756 |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C15H19N3O4/c1-8(19)13(16)14(20)18-12(15(21)22)6-9-7-17-11-5-3-2-4-10(9)11/h2-5,7-8,12-13,17,19H,6,16H2,1H3,(H,18,20)(H,21,22)/t8-,12+,13+/m1/s1 |
| InChIKey | KAFKKRJQHOECGW-JCOFBHIZSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Trp (CHEBI:73666) has functional parent L-threonine (CHEBI:16857) |
| Thr-Trp (CHEBI:73666) has functional parent L-tryptophan (CHEBI:16828) |
| Thr-Trp (CHEBI:73666) has role metabolite (CHEBI:25212) |
| Thr-Trp (CHEBI:73666) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-threonyl-L-tryptophan |
| Synonyms | Source |
|---|---|
| L-Thr-L-Trp | ChEBI |
| T-W | ChEBI |
| TW | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029072 | HMDB |