EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H16N2O4 |
| Net Charge | 0 |
| Average Mass | 216.237 |
| Monoisotopic Mass | 216.11101 |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C9H16N2O4/c1-5(12)7(10)8(13)11-4-2-3-6(11)9(14)15/h5-7,12H,2-4,10H2,1H3,(H,14,15)/t5-,6+,7+/m1/s1 |
| InChIKey | QOLYAJSZHIJCTO-VQVTYTSYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Pro (CHEBI:73662) has functional parent L-proline (CHEBI:17203) |
| Thr-Pro (CHEBI:73662) has functional parent L-threonine (CHEBI:16857) |
| Thr-Pro (CHEBI:73662) has role metabolite (CHEBI:25212) |
| Thr-Pro (CHEBI:73662) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-threonyl-L-proline |
| Synonyms | Source |
|---|---|
| L-Thr-L-Pro | ChEBI |
| TP | ChEBI |
| T-P | ChEBI |
| threonylproline | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029069 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8556868 | Reaxys |