EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H25N3O6 |
| Net Charge | 0 |
| Average Mass | 379.413 |
| Monoisotopic Mass | 379.17434 |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C18H25N3O6/c1-10(22)15(19)17(25)21-8-2-3-14(21)16(24)20-13(18(26)27)9-11-4-6-12(23)7-5-11/h4-7,10,13-15,22-23H,2-3,8-9,19H2,1H3,(H,20,24)(H,26,27)/t10-,13+,14+,15+/m1/s1 |
| InChIKey | YGZWVPBHYABGLT-KJEVXHAQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Pro-Tyr (CHEBI:73661) has functional parent L-proline (CHEBI:17203) |
| Thr-Pro-Tyr (CHEBI:73661) has functional parent L-threonine (CHEBI:16857) |
| Thr-Pro-Tyr (CHEBI:73661) has functional parent L-tyrosine (CHEBI:17895) |
| Thr-Pro-Tyr (CHEBI:73661) has role metabolite (CHEBI:25212) |
| Thr-Pro-Tyr (CHEBI:73661) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-threonyl-L-prolyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| L-Thr-L-Pro-L-Tyr | ChEBI |
| T-P-Y | ChEBI |
| TPY | ChEBI |