EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H24N4O7 |
| Net Charge | 0 |
| Average Mass | 420.422 |
| Monoisotopic Mass | 420.16450 |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C19H24N4O7/c1-9(24)16(20)18(28)22-13(17(27)23-14(19(29)30)7-15(25)26)6-10-8-21-12-5-3-2-4-11(10)12/h2-5,8-9,13-14,16,21,24H,6-7,20H2,1H3,(H,22,28)(H,23,27)(H,25,26)(H,29,30)/t9-,13+,14+,16+/m1/s1 |
| InChIKey | KHTIUAKJRUIEMA-HOUAVDHOSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Trp-Asp (CHEBI:73660) has functional parent L-aspartic acid (CHEBI:17053) |
| Thr-Trp-Asp (CHEBI:73660) has functional parent L-threonine (CHEBI:16857) |
| Thr-Trp-Asp (CHEBI:73660) has functional parent L-tryptophan (CHEBI:16828) |
| Thr-Trp-Asp (CHEBI:73660) has role metabolite (CHEBI:25212) |
| Thr-Trp-Asp (CHEBI:73660) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-threonyl-L-tryptophyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| L-Thr-L-Trp-L-Asp | ChEBI |
| T-W-D | ChEBI |
| TWD | ChEBI |