EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18N4O4 |
| Net Charge | 0 |
| Average Mass | 246.267 |
| Monoisotopic Mass | 246.13281 |
| SMILES | C[C@@H](N[C@@H](CCCNC(=N)N)C(=O)O)C(=O)O |
| InChI | InChI=1S/C9H18N4O4/c1-5(7(14)15)13-6(8(16)17)3-2-4-12-9(10)11/h5-6,13H,2-4H2,1H3,(H,14,15)(H,16,17)(H4,10,11,12)/t5-,6+/m1/s1 |
| InChIKey | IMXSCCDUAFEIOE-RITPCOANSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | animal metabolite Any eukaryotic metabolite produced during a metabolic reaction in animals that include diverse creatures from sponges, insects to mammals. xenobiotic metabolite Any metabolite produced by metabolism of a xenobiotic compound. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-octopine (CHEBI:15805) has role animal metabolite (CHEBI:75767) |
| D-octopine (CHEBI:15805) has role xenobiotic metabolite (CHEBI:76206) |
| D-octopine (CHEBI:15805) is a D-arginine derivative (CHEBI:83966) |
| D-octopine (CHEBI:15805) is a amino acid opine (CHEBI:83229) |
| D-octopine (CHEBI:15805) is a amino dicarboxylic acid (CHEBI:36164) |
| D-octopine (CHEBI:15805) is a guanidines (CHEBI:24436) |
| D-octopine (CHEBI:15805) is a secondary amino compound (CHEBI:50995) |
| D-octopine (CHEBI:15805) is conjugate acid of D-octopine(1−) (CHEBI:67037) |
| D-octopine (CHEBI:15805) is tautomer of D-octopine dizwitterion (CHEBI:57520) |
| Incoming Relation(s) |
| D-octopine(1−) (CHEBI:67037) is conjugate base of D-octopine (CHEBI:15805) |
| D-octopine dizwitterion (CHEBI:57520) is tautomer of D-octopine (CHEBI:15805) |
| IUPAC Name |
|---|
| N2-[(1R)-1-carboxyethyl]-L-arginine |
| Synonyms | Source |
|---|---|
| Arginine, N2-(1-carboxyethyl)-, L- | KEGG COMPOUND |
| D-(+)-Octopine | KEGG COMPOUND |
| D-Octopine | KEGG COMPOUND |
| N2-(D-1-carboxyethyl)-L-arginine | IUBMB |
| L-Arginine, N2-(1-carboxyethyl)-, (R)- | KEGG COMPOUND |
| L-Arginine, N2-[(1R)-1-carboxyethyl]- | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1729145 | Reaxys |
| CAS:34522-32-2 | KEGG COMPOUND |
| CAS:34522-32-2 | ChemIDplus |
| Citations |
|---|