EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18N4O4 |
| Net Charge | 0 |
| Average Mass | 246.267 |
| Monoisotopic Mass | 246.13281 |
| SMILES | C[C@@H]([NH2+][C@@H](CCCNC(N)=[NH2+])C(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C9H18N4O4/c1-5(7(14)15)13-6(8(16)17)3-2-4-12-9(10)11/h5-6,13H,2-4H2,1H3,(H,14,15)(H,16,17)(H4,10,11,12)/t5-,6+/m1/s1 |
| InChIKey | IMXSCCDUAFEIOE-RITPCOANSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-octopine dizwitterion (CHEBI:57520) is a D-α-amino acid zwitterion (CHEBI:59871) |
| D-octopine dizwitterion (CHEBI:57520) is conjugate acid of D-octopine(1−) (CHEBI:67037) |
| D-octopine dizwitterion (CHEBI:57520) is tautomer of D-octopine (CHEBI:15805) |
| Incoming Relation(s) |
| D-octopine(1−) (CHEBI:67037) is conjugate base of D-octopine dizwitterion (CHEBI:57520) |
| D-octopine (CHEBI:15805) is tautomer of D-octopine dizwitterion (CHEBI:57520) |
| IUPAC Name |
|---|
| (2S)-5-{[amino(iminiumyl)methyl]amino}-2-{[(1R)-1-carboxylatoethyl]azaniumyl}pentanoate |
| Synonym | Source |
|---|---|
| (2S)-5-{[amino(iminio)methyl]amino}-2-{[(1R)-1-carboxylatoethyl]ammonio}pentanoate | ChEBI |
| UniProt Name | Source |
|---|---|
| D-octopine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD-309 | MetaCyc |