EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H21N3O8 |
| Net Charge | 0 |
| Average Mass | 335.313 |
| Monoisotopic Mass | 335.13286 |
| SMILES | C[C@@H](O)[C@H](N)C(=O)N[C@H](C(=O)N[C@@H](CC(=O)O)C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C12H21N3O8/c1-4(16)8(13)10(20)15-9(5(2)17)11(21)14-6(12(22)23)3-7(18)19/h4-6,8-9,16-17H,3,13H2,1-2H3,(H,14,21)(H,15,20)(H,18,19)(H,22,23)/t4-,5-,6+,8+,9+/m1/s1 |
| InChIKey | YRJOLUDFVAUXLI-GSSVUCPTSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Thr-Thr-Asp (CHEBI:73659) has functional parent L-aspartic acid (CHEBI:17053) |
| Thr-Thr-Asp (CHEBI:73659) has functional parent L-threonine (CHEBI:16857) |
| Thr-Thr-Asp (CHEBI:73659) has role metabolite (CHEBI:25212) |
| Thr-Thr-Asp (CHEBI:73659) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-threonyl-L-threonyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| T-T-D | ChEBI |
| L-Thr-L-Thr-L-Asp | ChEBI |
| TTD | ChEBI |