EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N2O5 |
| Net Charge | 0 |
| Average Mass | 268.269 |
| Monoisotopic Mass | 268.10592 |
| SMILES | N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C12H16N2O5/c13-9(6-15)11(17)14-10(12(18)19)5-7-1-3-8(16)4-2-7/h1-4,9-10,15-16H,5-6,13H2,(H,14,17)(H,18,19)/t9-,10-/m0/s1 |
| InChIKey | MALNXHYEPCSPPU-UWVGGRQHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ser-Tyr (CHEBI:73652) has functional parent L-serine (CHEBI:17115) |
| Ser-Tyr (CHEBI:73652) has functional parent L-tyrosine (CHEBI:17895) |
| Ser-Tyr (CHEBI:73652) has role metabolite (CHEBI:25212) |
| Ser-Tyr (CHEBI:73652) is a dipeptide (CHEBI:46761) |
| Ser-Tyr (CHEBI:73652) is a phenols (CHEBI:33853) |
| Ser-Tyr (CHEBI:73652) is a primary alcohol (CHEBI:15734) |
| Ser-Tyr (CHEBI:73652) is a secondary carboxamide (CHEBI:140325) |
| IUPAC Name |
|---|
| L-seryl-L-tyrosine |
| Synonyms | Source |
|---|---|
| SY | ChEBI |
| S-Y | ChEBI |
| L-Ser-L-Tyr | ChEBI |
| seryltyrosine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029051 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2665243 | Reaxys |