EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H23N3O4 |
| Net Charge | 0 |
| Average Mass | 309.366 |
| Monoisotopic Mass | 309.16886 |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C15H23N3O4/c19-13(10-4-1-7-16-10)17-8-2-5-11(17)14(20)18-9-3-6-12(18)15(21)22/h10-12,16H,1-9H2,(H,21,22)/t10-,11-,12-/m0/s1 |
| InChIKey | SBVPYBFMIGDIDX-SRVKXCTJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pro-Pro-Pro (CHEBI:73647) has functional parent L-proline (CHEBI:17203) |
| Pro-Pro-Pro (CHEBI:73647) has role metabolite (CHEBI:25212) |
| Pro-Pro-Pro (CHEBI:73647) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-prolyl-L-prolyl-L-proline |
| Synonyms | Source |
|---|---|
| P-P-P | ChEBI |
| PPP | ChEBI |
| L-Pro-L-Pro-L-Pro | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:6532215 | Reaxys |