EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H16N2O3 |
| Net Charge | 0 |
| Average Mass | 212.249 |
| Monoisotopic Mass | 212.11609 |
| SMILES | O=C(O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1 |
| InChI | InChI=1S/C10H16N2O3/c13-9(7-3-1-5-11-7)12-6-2-4-8(12)10(14)15/h7-8,11H,1-6H2,(H,14,15)/t7-,8-/m0/s1 |
| InChIKey | RWCOTTLHDJWHRS-YUMQZZPRSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mycoplasma genitalium (ncbitaxon:2097) | - | PubMed (22817898) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | human urinary metabolite Any metabolite (endogenous or exogenous) found in human urine samples. Mycoplasma genitalium metabolite Any bacterial metabolite produced during a metabolic reaction in Mycoplasma genitalium. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pro-Pro (CHEBI:73646) has functional parent L-proline (CHEBI:17203) |
| Pro-Pro (CHEBI:73646) has role Mycoplasma genitalium metabolite (CHEBI:131604) |
| Pro-Pro (CHEBI:73646) has role human urinary metabolite (CHEBI:84087) |
| Pro-Pro (CHEBI:73646) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-prolyl-L-proline |
| Synonyms | Source |
|---|---|
| P-P | ChEBI |
| PP | ChEBI |
| prolylproline | ChEBI |
| L-Pro-L-Pro | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011180 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:17933 | Reaxys |
| Citations |
|---|