EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H21N5O3 |
| Net Charge | 0 |
| Average Mass | 271.321 |
| Monoisotopic Mass | 271.16444 |
| SMILES | N=C(N)NCCC[C@H](NC(=O)[C@@H]1CCCN1)C(=O)O |
| InChI | InChI=1S/C11H21N5O3/c12-11(13)15-6-2-4-8(10(18)19)16-9(17)7-3-1-5-14-7/h7-8,14H,1-6H2,(H,16,17)(H,18,19)(H4,12,13,15)/t7-,8-/m0/s1 |
| InChIKey | HMNSRTLZAJHSIK-YUMQZZPRSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Pro-Arg (CHEBI:73645) has functional parent L-arginine (CHEBI:16467) |
| Pro-Arg (CHEBI:73645) has functional parent L-proline (CHEBI:17203) |
| Pro-Arg (CHEBI:73645) has role metabolite (CHEBI:25212) |
| Pro-Arg (CHEBI:73645) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-prolyl-L-arginine |
| Synonyms | Source |
|---|---|
| P-R | ChEBI |
| PR | ChEBI |
| prolylarginine | ChEBI |
| L-Pro-L-Arg | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029011 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:34734 | Reaxys |
| CAS:2418-74-8 | ChemIDplus |