EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H25N3O6 |
| Net Charge | 0 |
| Average Mass | 427.457 |
| Monoisotopic Mass | 427.17434 |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C22H25N3O6/c23-16(11-14-7-3-1-4-8-14)20(28)24-17(12-15-9-5-2-6-10-15)21(29)25-18(22(30)31)13-19(26)27/h1-10,16-18H,11-13,23H2,(H,24,28)(H,25,29)(H,26,27)(H,30,31)/t16-,17-,18-/m0/s1 |
| InChIKey | KAJLHCWRWDSROH-BZSNNMDCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-Phe-Asp (CHEBI:73643) has functional parent L-aspartic acid (CHEBI:17053) |
| Phe-Phe-Asp (CHEBI:73643) has functional parent L-phenylalanine (CHEBI:17295) |
| Phe-Phe-Asp (CHEBI:73643) has role metabolite (CHEBI:25212) |
| Phe-Phe-Asp (CHEBI:73643) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-phenylalanyl-L-phenylalanyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| F-F-D | ChEBI |
| L-Phe-L-Phe-L-Asp | ChEBI |
| FFD | ChEBI |