EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H31N5O4 |
| Net Charge | 0 |
| Average Mass | 537.620 |
| Monoisotopic Mass | 537.23760 |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C31H31N5O4/c32-24(14-19-8-2-1-3-9-19)29(37)35-27(15-20-17-33-25-12-6-4-10-22(20)25)30(38)36-28(31(39)40)16-21-18-34-26-13-7-5-11-23(21)26/h1-13,17-18,24,27-28,33-34H,14-16,32H2,(H,35,37)(H,36,38)(H,39,40)/t24-,27-,28-/m0/s1 |
| InChIKey | MJOJSHOTYWABPR-WIRXVTQYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-Trp-Trp (CHEBI:73642) has functional parent L-phenylalanine (CHEBI:17295) |
| Phe-Trp-Trp (CHEBI:73642) has functional parent L-tryptophan (CHEBI:16828) |
| Phe-Trp-Trp (CHEBI:73642) has role metabolite (CHEBI:25212) |
| Phe-Trp-Trp (CHEBI:73642) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-phenylalanyl-L-tryptophyl-L-tryptophan |
| Synonyms | Source |
|---|---|
| F-W-W | ChEBI |
| FWW | ChEBI |
| L-Phe-L-Trp-L-Trp | ChEBI |