EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H18N2O4 |
| Net Charge | 0 |
| Average Mass | 266.297 |
| Monoisotopic Mass | 266.12666 |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C13H18N2O4/c1-8(16)11(13(18)19)15-12(17)10(14)7-9-5-3-2-4-6-9/h2-6,8,10-11,16H,7,14H2,1H3,(H,15,17)(H,18,19)/t8-,10+,11+/m1/s1 |
| InChIKey | NYQBYASWHVRESG-MIMYLULJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-Thr (CHEBI:73636) has functional parent L-phenylalanine (CHEBI:17295) |
| Phe-Thr (CHEBI:73636) has functional parent L-threonine (CHEBI:16857) |
| Phe-Thr (CHEBI:73636) has role metabolite (CHEBI:25212) |
| Phe-Thr (CHEBI:73636) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-phenylalanyl-L-threonine |
| Synonyms | Source |
|---|---|
| L-Phe-L-Thr | ChEBI |
| FT | ChEBI |
| F-T | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0029005 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:5072339 | Reaxys |