EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H16N2O5 |
| Net Charge | 0 |
| Average Mass | 280.280 |
| Monoisotopic Mass | 280.10592 |
| SMILES | N[C@@H](Cc1ccccc1)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C13H16N2O5/c14-9(6-8-4-2-1-3-5-8)12(18)15-10(13(19)20)7-11(16)17/h1-5,9-10H,6-7,14H2,(H,15,18)(H,16,17)(H,19,20)/t9-,10-/m0/s1 |
| InChIKey | HWMGTNOVUDIKRE-UWVGGRQHSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-Asp (CHEBI:73631) has functional parent L-aspartic acid (CHEBI:17053) |
| Phe-Asp (CHEBI:73631) has functional parent L-phenylalanine (CHEBI:17295) |
| Phe-Asp (CHEBI:73631) has role metabolite (CHEBI:25212) |
| Phe-Asp (CHEBI:73631) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-phenylalanyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| F-D | ChEBI |
| L-Phe-L-Asp | ChEBI |
| FD | ChEBI |
| phenylalanylaspartic acid | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028991 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:8784054 | Reaxys |