EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H16N2O3 |
| Net Charge | 0 |
| Average Mass | 236.271 |
| Monoisotopic Mass | 236.11609 |
| SMILES | C[C@H](NC(=O)[C@@H](N)Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C12H16N2O3/c1-8(12(16)17)14-11(15)10(13)7-9-5-3-2-4-6-9/h2-6,8,10H,7,13H2,1H3,(H,14,15)(H,16,17)/t8-,10-/m0/s1 |
| InChIKey | MIDZLCFIAINOQN-WPRPVWTQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-Ala (CHEBI:73630) has functional parent L-alanine (CHEBI:16977) |
| Phe-Ala (CHEBI:73630) has functional parent L-phenylalanine (CHEBI:17295) |
| Phe-Ala (CHEBI:73630) has role metabolite (CHEBI:25212) |
| Phe-Ala (CHEBI:73630) is a dipeptide (CHEBI:46761) |
| Phe-Ala (CHEBI:73630) is tautomer of Phe-Ala zwitterion (CHEBI:133146) |
| Incoming Relation(s) |
| Phe-Ala zwitterion (CHEBI:133146) is tautomer of Phe-Ala (CHEBI:73630) |
| IUPAC Name |
|---|
| L-phenylalanyl-L-alanine |
| Synonyms | Source |
|---|---|
| FA | ChEBI |
| L-Phe-L-Ala | ChEBI |
| F-A | ChEBI |
| phenylalanylalanine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028988 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2220413 | Reaxys |
| CAS:3918-87-4 | ChemIDplus |