EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O4 |
| Net Charge | 0 |
| Average Mass | 294.351 |
| Monoisotopic Mass | 294.15796 |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C15H22N2O4/c1-9(2)7-12(16)14(19)17-13(15(20)21)8-10-3-5-11(18)6-4-10/h3-6,9,12-13,18H,7-8,16H2,1-2H3,(H,17,19)(H,20,21)/t12-,13-/m0/s1 |
| InChIKey | LHSGPCFBGJHPCY-STQMWFEESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Tyr (CHEBI:73591) has functional parent L-leucine (CHEBI:15603) |
| Leu-Tyr (CHEBI:73591) has functional parent L-tyrosine (CHEBI:17895) |
| Leu-Tyr (CHEBI:73591) has role metabolite (CHEBI:25212) |
| Leu-Tyr (CHEBI:73591) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-leucyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| L-Y | ChEBI |
| L-Leu-L-Tyr | ChEBI |
| LY | ChEBI |
| Leucyltyrosine | ChemIDplus |
| leucyltyrosine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028941 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2949763 | Reaxys |
| CAS:968-21-8 | ChemIDplus |