EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H23N3O3 |
| Net Charge | 0 |
| Average Mass | 317.389 |
| Monoisotopic Mass | 317.17394 |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C17H23N3O3/c1-10(2)7-13(18)16(21)20-15(17(22)23)8-11-9-19-14-6-4-3-5-12(11)14/h3-6,9-10,13,15,19H,7-8,18H2,1-2H3,(H,20,21)(H,22,23)/t13-,15-/m0/s1 |
| InChIKey | BQVUABVGYYSDCJ-ZFWWWQNUSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Trp (CHEBI:73590) has functional parent L-leucine (CHEBI:15603) |
| Leu-Trp (CHEBI:73590) has functional parent L-tryptophan (CHEBI:16828) |
| Leu-Trp (CHEBI:73590) has role metabolite (CHEBI:25212) |
| Leu-Trp (CHEBI:73590) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-leucyl-L-tryptophan |
| Synonyms | Source |
|---|---|
| L-W | ChEBI |
| L-Leu-L-Trp | ChEBI |
| LW | ChEBI |
| leucyltryptophan | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028940 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:94548 | Reaxys |