EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H22N2O3 |
| Net Charge | 0 |
| Average Mass | 278.352 |
| Monoisotopic Mass | 278.16304 |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C15H22N2O3/c1-10(2)8-12(16)14(18)17-13(15(19)20)9-11-6-4-3-5-7-11/h3-7,10,12-13H,8-9,16H2,1-2H3,(H,17,18)(H,19,20)/t12-,13-/m0/s1 |
| InChIKey | KFKWRHQBZQICHA-STQMWFEESA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Phe (CHEBI:73585) has functional parent L-leucine (CHEBI:15603) |
| Leu-Phe (CHEBI:73585) has functional parent L-phenylalanine (CHEBI:17295) |
| Leu-Phe (CHEBI:73585) has role metabolite (CHEBI:25212) |
| Leu-Phe (CHEBI:73585) is a dipeptide (CHEBI:46761) |
| Leu-Phe (CHEBI:73585) is tautomer of Leu-Phe zwitterion (CHEBI:233080) |
| Incoming Relation(s) |
| Leu-Phe zwitterion (CHEBI:233080) is tautomer of Leu-Phe (CHEBI:73585) |
| IUPAC Name |
|---|
| L-leucyl-L-phenylalanine |
| Synonyms | Source |
|---|---|
| leucylphenylalanine | ChEBI |
| L-F | ChEBI |
| LF | ChEBI |
| L-Leu-L-Phe | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0013243 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2815177 | Reaxys |