EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H29N3O5 |
| Net Charge | 0 |
| Average Mass | 391.468 |
| Monoisotopic Mass | 391.21072 |
| SMILES | CC(C)C[C@H](N)C(=O)N1CCC[C@H]1C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C20H29N3O5/c1-12(2)10-15(21)19(26)23-9-3-4-17(23)18(25)22-16(20(27)28)11-13-5-7-14(24)8-6-13/h5-8,12,15-17,24H,3-4,9-11,21H2,1-2H3,(H,22,25)(H,27,28)/t15-,16-,17-/m0/s1 |
| InChIKey | UCXQIIIFOOGYEM-ULQDDVLXSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Pro-Tyr (CHEBI:73581) has functional parent L-leucine (CHEBI:15603) |
| Leu-Pro-Tyr (CHEBI:73581) has functional parent L-proline (CHEBI:17203) |
| Leu-Pro-Tyr (CHEBI:73581) has functional parent L-tyrosine (CHEBI:17895) |
| Leu-Pro-Tyr (CHEBI:73581) has role metabolite (CHEBI:25212) |
| Leu-Pro-Tyr (CHEBI:73581) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-leucyl-L-prolyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| L-P-Y | ChEBI |
| LPY | ChEBI |
| L-Leu-L-Pro-L-Tyr | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:58567 | Reaxys |