EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H20N2O3 |
| Net Charge | 0 |
| Average Mass | 228.292 |
| Monoisotopic Mass | 228.14739 |
| SMILES | CC(C)C[C@H](N)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C11H20N2O3/c1-7(2)6-8(12)10(14)13-5-3-4-9(13)11(15)16/h7-9H,3-6,12H2,1-2H3,(H,15,16)/t8-,9-/m0/s1 |
| InChIKey | VTJUNIYRYIAIHF-IUCAKERBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Pro (CHEBI:73580) has functional parent L-leucine (CHEBI:15603) |
| Leu-Pro (CHEBI:73580) has functional parent L-proline (CHEBI:17203) |
| Leu-Pro (CHEBI:73580) has role metabolite (CHEBI:25212) |
| Leu-Pro (CHEBI:73580) is a dipeptide (CHEBI:46761) |
| Leu-Pro (CHEBI:73580) is tautomer of Leu-Pro zwitterion (CHEBI:155847) |
| Incoming Relation(s) |
| Leu-Pro zwitterion (CHEBI:155847) is tautomer of Leu-Pro (CHEBI:73580) |
| IUPAC Name |
|---|
| L-leucyl-L-proline |
| Synonyms | Source |
|---|---|
| leucylproline | ChEBI |
| L-P | ChEBI |
| LP | ChEBI |
| L-Leu-L-Pro | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0011175 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:4748532 | Reaxys |
| CAS:6403-35-6 | ChemIDplus |