EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H28N4O6 |
| Net Charge | 0 |
| Average Mass | 360.411 |
| Monoisotopic Mass | 360.20088 |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@H](C(=O)N[C@@H](CCC(N)=O)C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C15H28N4O6/c1-7(2)6-9(16)13(22)19-12(8(3)20)14(23)18-10(15(24)25)4-5-11(17)21/h7-10,12,20H,4-6,16H2,1-3H3,(H2,17,21)(H,18,23)(H,19,22)(H,24,25)/t8-,9+,10+,12+/m1/s1 |
| InChIKey | LCNASHSOFMRYFO-WDCWCFNPSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Thr-Gln (CHEBI:73574) has functional parent L-glutamine (CHEBI:18050) |
| Leu-Thr-Gln (CHEBI:73574) has functional parent L-leucine (CHEBI:15603) |
| Leu-Thr-Gln (CHEBI:73574) has functional parent L-threonine (CHEBI:16857) |
| Leu-Thr-Gln (CHEBI:73574) has role metabolite (CHEBI:25212) |
| Leu-Thr-Gln (CHEBI:73574) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-leucyl-L-threonyl-L-glutamine |
| Synonyms | Source |
|---|---|
| L-Leu-L-Thr-L-Gln | ChEBI |
| L-T-Q | ChEBI |
| LTQ | ChEBI |