EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H25N3O7 |
| Net Charge | 0 |
| Average Mass | 347.368 |
| Monoisotopic Mass | 347.16925 |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@H](C(=O)N[C@@H](CC(=O)O)C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C14H25N3O7/c1-6(2)4-8(15)12(21)17-11(7(3)18)13(22)16-9(14(23)24)5-10(19)20/h6-9,11,18H,4-5,15H2,1-3H3,(H,16,22)(H,17,21)(H,19,20)(H,23,24)/t7-,8+,9+,11+/m1/s1 |
| InChIKey | ICYRCNICGBJLGM-HJGDQZAQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Thr-Asp (CHEBI:73573) has functional parent L-aspartic acid (CHEBI:17053) |
| Leu-Thr-Asp (CHEBI:73573) has functional parent L-leucine (CHEBI:15603) |
| Leu-Thr-Asp (CHEBI:73573) has functional parent L-threonine (CHEBI:16857) |
| Leu-Thr-Asp (CHEBI:73573) has role metabolite (CHEBI:25212) |
| Leu-Thr-Asp (CHEBI:73573) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-leucyl- L-threonyl- L-aspartic acid |
| Synonyms | Source |
|---|---|
| L-T-D | ChEBI |
| LTD | ChEBI |
| L-Leu-L-Thr-L-Asp | ChEBI |