EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H25N3O5 |
| Net Charge | 0 |
| Average Mass | 303.359 |
| Monoisotopic Mass | 303.17942 |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@H](C(=O)N[C@@H](C)C(=O)O)[C@@H](C)O |
| InChI | InChI=1S/C13H25N3O5/c1-6(2)5-9(14)11(18)16-10(8(4)17)12(19)15-7(3)13(20)21/h6-10,17H,5,14H2,1-4H3,(H,15,19)(H,16,18)(H,20,21)/t7-,8+,9-,10-/m0/s1 |
| InChIKey | ZJZNLRVCZWUONM-JXUBOQSCSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Thr-Ala (CHEBI:73572) has functional parent L-alanine (CHEBI:16977) |
| Leu-Thr-Ala (CHEBI:73572) has functional parent L-leucine (CHEBI:15603) |
| Leu-Thr-Ala (CHEBI:73572) has functional parent L-threonine (CHEBI:16857) |
| Leu-Thr-Ala (CHEBI:73572) has role metabolite (CHEBI:25212) |
| Leu-Thr-Ala (CHEBI:73572) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-leucyl-L-threonyl-L-alanine |
| Synonyms | Source |
|---|---|
| LTA | ChEBI |
| L-Leu-L-Thr-L-Ala | ChEBI |
| L-T-A | ChEBI |