EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H29N3O6 |
| Net Charge | 0 |
| Average Mass | 359.423 |
| Monoisotopic Mass | 359.20564 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CC(C)C)C(=O)N[C@@H](CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H29N3O6/c1-8(2)5-10(17)14(22)18-11(6-9(3)4)15(23)19-12(16(24)25)7-13(20)21/h8-12H,5-7,17H2,1-4H3,(H,18,22)(H,19,23)(H,20,21)(H,24,25)/t10-,11-,12-/m0/s1 |
| InChIKey | PDQDCFBVYXEFSD-SRVKXCTJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Leu-Asp (CHEBI:73567) has functional parent L-aspartic acid (CHEBI:17053) |
| Leu-Leu-Asp (CHEBI:73567) has functional parent L-leucine (CHEBI:15603) |
| Leu-Leu-Asp (CHEBI:73567) has role metabolite (CHEBI:25212) |
| Leu-Leu-Asp (CHEBI:73567) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-leucyl-L-leucyl-L-aspartic acid |
| Synonyms | Source |
|---|---|
| L-L-D | ChEBI |
| LLD | ChEBI |
| L-Leu-L-Leu-L-Asp | ChEBI |