EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H30N4O5 |
| Net Charge | 0 |
| Average Mass | 358.439 |
| Monoisotopic Mass | 358.22162 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CC(C)C)C(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C16H30N4O5/c1-8(2)5-10(17)14(22)19-11(6-9(3)4)15(23)20-12(16(24)25)7-13(18)21/h8-12H,5-7,17H2,1-4H3,(H2,18,21)(H,19,22)(H,20,23)(H,24,25)/t10-,11-,12-/m0/s1 |
| InChIKey | IAJFFZORSWOZPQ-SRVKXCTJSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Leu-Asn (CHEBI:73566) has functional parent L-asparagine (CHEBI:17196) |
| Leu-Leu-Asn (CHEBI:73566) has functional parent L-leucine (CHEBI:15603) |
| Leu-Leu-Asn (CHEBI:73566) has role metabolite (CHEBI:25212) |
| Leu-Leu-Asn (CHEBI:73566) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-leucyl-L-leucyl-L-asparagine |
| Synonyms | Source |
|---|---|
| L-L-N | ChEBI |
| LLN | ChEBI |
| L-Leu-L-Leu-L-Asn | ChEBI |