EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H23N3O7 |
| Net Charge | 0 |
| Average Mass | 333.341 |
| Monoisotopic Mass | 333.15360 |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@@H](CC(=O)O)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C13H23N3O7/c1-6(2)3-7(14)11(20)15-8(4-10(18)19)12(21)16-9(5-17)13(22)23/h6-9,17H,3-5,14H2,1-2H3,(H,15,20)(H,16,21)(H,18,19)(H,22,23)/t7-,8-,9-/m0/s1 |
| InChIKey | PVMPDMIKUVNOBD-CIUDSAMLSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Asp-Ser (CHEBI:73563) has functional parent L-aspartic acid (CHEBI:17053) |
| Leu-Asp-Ser (CHEBI:73563) has functional parent L-leucine (CHEBI:15603) |
| Leu-Asp-Ser (CHEBI:73563) has functional parent L-serine (CHEBI:17115) |
| Leu-Asp-Ser (CHEBI:73563) has role metabolite (CHEBI:25212) |
| Leu-Asp-Ser (CHEBI:73563) is a tripeptide (CHEBI:47923) |
| IUPAC Name |
|---|
| L-leucyl-L-α-aspartyl-L-serine |
| Synonyms | Source |
|---|---|
| LDS | ChEBI |
| L-Leu-L-Asp-L-Ser | ChEBI |
| L-D-S | ChEBI |