EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15N3O7S |
| Net Charge | 0 |
| Average Mass | 417.399 |
| Monoisotopic Mass | 417.06307 |
| SMILES | CC(=O)N[C@@H](CSc1c2nc3cc(C(=O)O)ccc3oc-2cc(=O)c1N)C(=O)O |
| InChI | InChI=1S/C18H15N3O7S/c1-7(22)20-10(18(26)27)6-29-16-14(19)11(23)5-13-15(16)21-9-4-8(17(24)25)2-3-12(9)28-13/h2-5,10H,6,19H2,1H3,(H,20,22)(H,24,25)(H,26,27)/t10-/m0/s1 |
| InChIKey | KUPQDUIOULXTJZ-JTQLQIEISA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| grixazone B (CHEBI:73548) has role metabolite (CHEBI:25212) |
| grixazone B (CHEBI:73548) is a N-acetyl-amino acid (CHEBI:21575) |
| grixazone B (CHEBI:73548) is a L-cysteine derivative (CHEBI:83824) |
| grixazone B (CHEBI:73548) is a cysteine derivative (CHEBI:23509) |
| grixazone B (CHEBI:73548) is a phenoxazine (CHEBI:25970) |
| grixazone B (CHEBI:73548) is conjugate acid of grixazone B(2−) (CHEBI:73483) |
| Incoming Relation(s) |
| grixazone B(2−) (CHEBI:73483) is conjugate base of grixazone B (CHEBI:73548) |
| IUPAC Name |
|---|
| 1-{[(2R)-2-acetamido-2-carboxylatoethyl]sulfanyl}-2-amino-3-oxo-3H-phenoxazine-8-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| CPD-14875 | MetaCyc |
| Registry Numbers | Sources |
|---|---|
| Reaxys:20932870 | Reaxys |
| Citations |
|---|