EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15N3O6S |
| Net Charge | 0 |
| Average Mass | 401.400 |
| Monoisotopic Mass | 401.06816 |
| SMILES | [H]C(=O)c1ccc2oc3cc(=O)c(N)c(SC[C@H](NC(C)=O)C(=O)O)c-3nc2c1 |
| InChI | InChI=1S/C18H15N3O6S/c1-8(23)20-11(18(25)26)7-28-17-15(19)12(24)5-14-16(17)21-10-4-9(6-22)2-3-13(10)27-14/h2-6,11H,7,19H2,1H3,(H,20,23)(H,25,26)/t11-/m0/s1 |
| InChIKey | CBXHEDPBKOZZSI-NSHDSACASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| grixazone A (CHEBI:73546) has role metabolite (CHEBI:25212) |
| grixazone A (CHEBI:73546) is a N-acetyl-amino acid (CHEBI:21575) |
| grixazone A (CHEBI:73546) is a L-cysteine derivative (CHEBI:83824) |
| grixazone A (CHEBI:73546) is a arenecarbaldehyde (CHEBI:33855) |
| grixazone A (CHEBI:73546) is a phenoxazine (CHEBI:25970) |
| grixazone A (CHEBI:73546) is conjugate acid of grixazone A(1−) (CHEBI:73482) |
| Incoming Relation(s) |
| grixazone A(1−) (CHEBI:73482) is conjugate base of grixazone A (CHEBI:73546) |
| IUPAC Name |
|---|
| N-acetyl-S-(2-amino-8-formyl-3-oxo-3H-phenoxazin-1-yl)-L-cysteine |
| Manual Xrefs | Databases |
|---|---|
| CPD-14874 | MetaCyc |
| Citations |
|---|