EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C10H19N3O4 |
| Net Charge | 0 |
| Average Mass | 245.279 |
| Monoisotopic Mass | 245.13756 |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@@H](CC(N)=O)C(=O)O |
| InChI | InChI=1S/C10H19N3O4/c1-5(2)3-6(11)9(15)13-7(10(16)17)4-8(12)14/h5-7H,3-4,11H2,1-2H3,(H2,12,14)(H,13,15)(H,16,17)/t6-,7-/m0/s1 |
| InChIKey | MLTRLIITQPXHBJ-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Asn (CHEBI:73529) has functional parent L-asparagine (CHEBI:17196) |
| Leu-Asn (CHEBI:73529) has functional parent L-leucine (CHEBI:15603) |
| Leu-Asn (CHEBI:73529) has role metabolite (CHEBI:25212) |
| Leu-Asn (CHEBI:73529) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-leucyl-L-asparagine |
| Synonyms | Source |
|---|---|
| LN | ChEBI |
| L-Leu-L-Asn | ChEBI |
| L-N | ChEBI |
| leucylasparagine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028924 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1728613 | Reaxys |