EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H18N2O4 |
| Net Charge | 0 |
| Average Mass | 218.253 |
| Monoisotopic Mass | 218.12666 |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@@H](CO)C(=O)O |
| InChI | InChI=1S/C9H18N2O4/c1-5(2)3-6(10)8(13)11-7(4-12)9(14)15/h5-7,12H,3-4,10H2,1-2H3,(H,11,13)(H,14,15)/t6-,7-/m0/s1 |
| InChIKey | XGDCYUQSFDQISZ-BQBZGAKWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Ser (CHEBI:73523) has functional parent L-leucine (CHEBI:15603) |
| Leu-Ser (CHEBI:73523) has functional parent L-serine (CHEBI:17115) |
| Leu-Ser (CHEBI:73523) has role metabolite (CHEBI:25212) |
| Leu-Ser (CHEBI:73523) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| L-leucyl-L-serine |
| Synonyms | Source |
|---|---|
| L-S | ChEBI |
| L-Leu-L-Ser | ChEBI |
| LS | ChEBI |
| leucylserine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| HMDB0028938 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1727668 | Reaxys |