EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32N4O8 |
| Net Charge | 0 |
| Average Mass | 468.507 |
| Monoisotopic Mass | 468.22201 |
| SMILES | CC(C)C[C@H](N)C(=O)N[C@@H](CO)C(=O)N[C@@H](CO)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C21H32N4O8/c1-11(2)7-14(22)18(29)24-16(9-26)20(31)25-17(10-27)19(30)23-15(21(32)33)8-12-3-5-13(28)6-4-12/h3-6,11,14-17,26-28H,7-10,22H2,1-2H3,(H,23,30)(H,24,29)(H,25,31)(H,32,33)/t14-,15-,16-,17-/m0/s1 |
| InChIKey | SIGZKCWZEBFNAK-QAETUUGQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Leu-Ser-Ser-Tyr (CHEBI:73522) has functional parent L-leucine (CHEBI:15603) |
| Leu-Ser-Ser-Tyr (CHEBI:73522) has functional parent L-serine (CHEBI:17115) |
| Leu-Ser-Ser-Tyr (CHEBI:73522) has functional parent L-tyrosine (CHEBI:17895) |
| Leu-Ser-Ser-Tyr (CHEBI:73522) has role metabolite (CHEBI:25212) |
| Leu-Ser-Ser-Tyr (CHEBI:73522) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-leucyl-L-seryl-L-seryl-L-tyrosine |
| Synonyms | Source |
|---|---|
| L-S-S-Y | ChEBI |
| LSSY | ChEBI |
| L-Leu-L-Ser-L-Ser-L-Tyr | ChEBI |