EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H44N6O5 |
| Net Charge | 0 |
| Average Mass | 616.763 |
| Monoisotopic Mass | 616.33732 |
| SMILES | CC[C@H](C)[C@H](N)C(=O)N[C@@H](CC(C)C)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C34H44N6O5/c1-5-20(4)30(35)33(43)39-27(14-19(2)3)31(41)38-28(15-21-17-36-25-12-8-6-10-23(21)25)32(42)40-29(34(44)45)16-22-18-37-26-13-9-7-11-24(22)26/h6-13,17-20,27-30,36-37H,5,14-16,35H2,1-4H3,(H,38,41)(H,39,43)(H,40,42)(H,44,45)/t20-,27-,28-,29-,30-/m0/s1 |
| InChIKey | DGPLWSJZLQMHSN-FXFLXJQASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ile-Leu-Trp-Trp (CHEBI:73518) has functional parent L-isoleucine (CHEBI:17191) |
| Ile-Leu-Trp-Trp (CHEBI:73518) has functional parent L-leucine (CHEBI:15603) |
| Ile-Leu-Trp-Trp (CHEBI:73518) has functional parent L-tryptophan (CHEBI:16828) |
| Ile-Leu-Trp-Trp (CHEBI:73518) has role metabolite (CHEBI:25212) |
| Ile-Leu-Trp-Trp (CHEBI:73518) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-isoleucyl-L-leucyl-L-tryptophyl-L-tryptophan |
| Synonyms | Source |
|---|---|
| I-L-W-W | ChEBI |
| ILWW | ChEBI |
| L-Ile-L-Leu-L-Trp-L-Trp | ChEBI |