EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H8O2 |
| Net Charge | 0 |
| Average Mass | 112.128 |
| Monoisotopic Mass | 112.05243 |
| SMILES | C#CCCCC(=O)O |
| InChI | InChI=1S/C6H8O2/c1-2-3-4-5-6(7)8/h1H,3-5H2,(H,7,8) |
| InChIKey | VPFMEXRVUOPYRG-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| hex-5-ynoic acid (CHEBI:73511) is a hexynoic acid (CHEBI:48444) |
| hex-5-ynoic acid (CHEBI:73511) is a terminal acetylenic compound (CHEBI:73477) |
| IUPAC Name |
|---|
| hex-5-ynoic acid |
| Synonym | Source |
|---|---|
| 5-hexynoic acid | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:1743192 | Reaxys |
| CAS:53293-00-8 | ChemIDplus |
| CAS:53293-00-8 | NIST Chemistry WebBook |
| Citations |
|---|