EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H34N2O7 |
| Net Charge | 0 |
| Average Mass | 546.620 |
| Monoisotopic Mass | 546.23660 |
| SMILES | O=C(/C=C/C=C/C=C/C1CCCCC1)NC1=C[C@@](O)(/C=C/C=C/C=C/C(=O)NC2=C(O)CCC2=O)[C@@H]2O[C@@H]2C1=O |
| InChI | InChI=1S/C31H34N2O7/c34-23-17-18-24(35)27(23)33-26(37)16-10-3-4-11-19-31(39)20-22(28(38)29-30(31)40-29)32-25(36)15-9-2-1-6-12-21-13-7-5-8-14-21/h1-4,6,9-12,15-16,19-21,29-30,34,39H,5,7-8,13-14,17-18H2,(H,32,36)(H,33,37)/b2-1+,4-3+,12-6+,15-9+,16-10+,19-11+/t29-,30-,31+/m1/s1 |
| InChIKey | SSHVAUUEPNULMP-JHWDTTIQSA-N |
| Roles Classification |
|---|
| Biological Roles: | antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asukamycin (CHEBI:73481) has functional parent 4-hydroxyprotoasukamycin (CHEBI:90902) |
| asukamycin (CHEBI:73481) has role antibacterial agent (CHEBI:33282) |
| asukamycin (CHEBI:73481) has role antifungal agent (CHEBI:35718) |
| asukamycin (CHEBI:73481) has role antimicrobial agent (CHEBI:33281) |
| asukamycin (CHEBI:73481) has role antineoplastic agent (CHEBI:35610) |
| asukamycin (CHEBI:73481) has role bacterial metabolite (CHEBI:76969) |
| asukamycin (CHEBI:73481) is a enamide (CHEBI:51751) |
| asukamycin (CHEBI:73481) is a epoxide (CHEBI:32955) |
| asukamycin (CHEBI:73481) is a organic heterobicyclic compound (CHEBI:27171) |
| asukamycin (CHEBI:73481) is a polyketide (CHEBI:26188) |
| asukamycin (CHEBI:73481) is a secondary carboxamide (CHEBI:140325) |
| asukamycin (CHEBI:73481) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2E,4E,6E)-7-cyclohexyl-N-[(1S,5S,6R)-5-hydroxy-5-{(1E,3E,5E)-7-[(2-hydroxy-5-oxocyclopent-1-en-1-yl)amino]-7-oxohepta-1,3,5-trien-1-yl}-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl]hepta-2,4,6-trienamide |
| Synonyms | Source |
|---|---|
| AM 1042 | ChemIDplus |
| Asukamycin | KEGG COMPOUND |
| asukamycin A1 | ChEBI |
| UniProt Name | Source |
|---|---|
| asukamycin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3639742 | Beilstein |
| Reaxys:6674537 | Reaxys |
| CAS:61116-33-4 | KEGG COMPOUND |
| CAS:61116-33-4 | ChemIDplus |
| Citations |
|---|