EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H34N2O7 |
| Net Charge | 0 |
| Average Mass | 546.620 |
| Monoisotopic Mass | 546.23660 |
| SMILES | O=C(/C=C/C=C/C=C/C1CCCCC1)NC1=C[C@@](O)(/C=C/C=C/C=C/C(=O)NC2=C(O)CCC2=O)[C@@H]2O[C@@H]2C1=O |
| InChI | InChI=1S/C31H34N2O7/c34-23-17-18-24(35)27(23)33-26(37)16-10-3-4-11-19-31(39)20-22(28(38)29-30(31)40-29)32-25(36)15-9-2-1-6-12-21-13-7-5-8-14-21/h1-4,6,9-12,15-16,19-21,29-30,34,39H,5,7-8,13-14,17-18H2,(H,32,36)(H,33,37)/b2-1+,4-3+,12-6+,15-9+,16-10+,19-11+/t29-,30-,31+/m1/s1 |
| InChIKey | SSHVAUUEPNULMP-JHWDTTIQSA-N |
| Roles Classification |
|---|
| Biological Roles: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. antimicrobial agent A substance that kills or slows the growth of microorganisms, including bacteria, viruses, fungi and protozoans. antifungal agent An antimicrobial agent that destroys fungi by suppressing their ability to grow or reproduce. antibacterial agent A substance (or active part thereof) that kills or slows the growth of bacteria. |
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| asukamycin (CHEBI:73481) has functional parent 4-hydroxyprotoasukamycin (CHEBI:90902) |
| asukamycin (CHEBI:73481) has role antibacterial agent (CHEBI:33282) |
| asukamycin (CHEBI:73481) has role antifungal agent (CHEBI:35718) |
| asukamycin (CHEBI:73481) has role antimicrobial agent (CHEBI:33281) |
| asukamycin (CHEBI:73481) has role antineoplastic agent (CHEBI:35610) |
| asukamycin (CHEBI:73481) has role bacterial metabolite (CHEBI:76969) |
| asukamycin (CHEBI:73481) is a enamide (CHEBI:51751) |
| asukamycin (CHEBI:73481) is a epoxide (CHEBI:32955) |
| asukamycin (CHEBI:73481) is a organic heterobicyclic compound (CHEBI:27171) |
| asukamycin (CHEBI:73481) is a polyketide (CHEBI:26188) |
| asukamycin (CHEBI:73481) is a secondary carboxamide (CHEBI:140325) |
| asukamycin (CHEBI:73481) is a tertiary alcohol (CHEBI:26878) |
| IUPAC Name |
|---|
| (2E,4E,6E)-7-cyclohexyl-N-[(1S,5S,6R)-5-hydroxy-5-{(1E,3E,5E)-7-[(2-hydroxy-5-oxocyclopent-1-en-1-yl)amino]-7-oxohepta-1,3,5-trien-1-yl}-2-oxo-7-oxabicyclo[4.1.0]hept-3-en-3-yl]hepta-2,4,6-trienamide |
| Synonyms | Source |
|---|---|
| AM 1042 | ChemIDplus |
| Asukamycin | KEGG COMPOUND |
| asukamycin A1 | ChEBI |
| UniProt Name | Source |
|---|---|
| asukamycin | UniProt |
| Registry Numbers | Sources |
|---|---|
| Beilstein:3639742 | Beilstein |
| Reaxys:6674537 | Reaxys |
| CAS:61116-33-4 | KEGG COMPOUND |
| CAS:61116-33-4 | ChemIDplus |
| Citations |
|---|