EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C44H82O11 |
| Net Charge | 0 |
| Average Mass | 787.129 |
| Monoisotopic Mass | 786.58571 |
| SMILES | CCCCCCCCCCCCCCCC(=O)OC[C@H](CO[C@H]1O[C@H](C(=O)O)[C@@H](O)[C@H](O)[C@H]1O)OC(=O)CCCCCCCC[C@H](C)CCCCCCCC |
| InChI | InChI=1S/C44H82O11/c1-4-6-8-10-12-13-14-15-16-17-18-23-27-31-37(45)52-33-36(34-53-44-41(49)39(47)40(48)42(55-44)43(50)51)54-38(46)32-28-24-20-19-22-26-30-35(3)29-25-21-11-9-7-5-2/h35-36,39-42,44,47-49H,4-34H2,1-3H3,(H,50,51)/t35-,36-,39+,40+,41-,42+,44+/m1/s1 |
| InChIKey | IGBSGSATGZRQHP-KZEZPSQDSA-N |
| Roles Classification |
|---|
| Biological Role: | antigen Any substance that stimulates an immune response in the body, such as through antibody production or by presentation to a T-cell receptor after binding to a major histocompability complex (MHC). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-α-D-glucuronosyl-2-[(10R)-10-methyloctadecanoyl]-1-palmitoyl-sn-glycerol (CHEBI:73476) has role antigen (CHEBI:59132) |
| 3-α-D-glucuronosyl-2-[(10R)-10-methyloctadecanoyl]-1-palmitoyl-sn-glycerol (CHEBI:73476) is a α-D-glucuronosyl diglyceride (CHEBI:73470) |
| IUPAC Name |
|---|
| (2S)-3-(hexadecanoyloxy)-2-{[(10R)-10-methyloctadecanoyl]oxy}propyl α-D-glucopyranosiduronic acid |
| Synonyms | Source |
|---|---|
| (2S)-2-{[(10R)-10-methyloctadecanoyl]oxy}-3-(palmitoyloxy)propyl α-D-glucopyranosiduronic acid | IUPAC |
| α-GlcA-DAG (C16:0/C19:0) | ChEBI |
| α-GlcA-DAG (C16:0/C19:0) from Mycobacterium smegmatis | ChEBI |
| Citations |
|---|