EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H12N2O |
| Net Charge | 0 |
| Average Mass | 164.208 |
| Monoisotopic Mass | 164.09496 |
| SMILES | NCCC(=O)c1ccccc1N |
| InChI | InChI=1S/C9H12N2O/c10-6-5-9(12)7-3-1-2-4-8(7)11/h1-4H,5-6,10-11H2 |
| InChIKey | QLPVTIQQFGWSQQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| kynuramine (CHEBI:73472) has role metabolite (CHEBI:25212) |
| kynuramine (CHEBI:73472) is a kynurenamines (CHEBI:24990) |
| kynuramine (CHEBI:73472) is a primary amino compound (CHEBI:50994) |
| kynuramine (CHEBI:73472) is conjugate base of kynuramine(1+) (CHEBI:180898) |
| Incoming Relation(s) |
| kynuramine(1+) (CHEBI:180898) is conjugate acid of kynuramine (CHEBI:73472) |
| IUPAC Name |
|---|
| 3-amino-1-(2-aminophenyl)propan-1-one |
| Synonyms | Source |
|---|---|
| 2',3-diaminopropiophenone | ChEBI |
| 3-amino-1-(2-aminophenyl)-1-propanone | ChEBI |
| kynurenamine | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| WO2006061140 | Patent |
| HMDB0012246 | HMDB |
| FDB028888 | FooDB |
| 9311 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:2802772 | Reaxys |
| CAS:363-36-0 | ChemIDplus |
| Citations |
|---|