EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H23NO2 |
| Net Charge | 0 |
| Average Mass | 309.409 |
| Monoisotopic Mass | 309.17288 |
| SMILES | CN1CCC(OC(=O)C(c2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C20H23NO2/c1-21-14-12-18(13-15-21)23-20(22)19(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,18-19H,12-15H2,1H3 |
| InChIKey | HVLMWCBEAXEKAD-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| Application: | muscarinic antagonist A drug that binds to but does not activate muscarinic cholinergic receptors, thereby blocking the actions of endogenous acetylcholine or exogenous agonists. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-diphenylacetoxy-N-methylpiperidine (CHEBI:73469) has role muscarinic antagonist (CHEBI:48876) |
| 4-diphenylacetoxy-N-methylpiperidine (CHEBI:73469) is a carboxylic ester (CHEBI:33308) |
| 4-diphenylacetoxy-N-methylpiperidine (CHEBI:73469) is a piperidines (CHEBI:26151) |
| 4-diphenylacetoxy-N-methylpiperidine (CHEBI:73469) is a tertiary amino compound (CHEBI:50996) |
| Synonym | Source |
|---|---|
| 1-methylpiperidin-4-yl diphenylacetate | ChEBI |
| Registry Numbers | Sources |
|---|---|
| Reaxys:262807 | Reaxys |
| Citations |
|---|