EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C34H38N6O7 |
| Net Charge | 0 |
| Average Mass | 642.713 |
| Monoisotopic Mass | 642.28020 |
| SMILES | NC(=O)CC[C@H](N)C(=O)N[C@@H](Cc1ccccc1)C(=O)N[C@@H](Cc1cnc2ccccc12)C(=O)N[C@@H](Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C34H38N6O7/c35-25(14-15-30(36)42)31(43)38-27(16-20-6-2-1-3-7-20)32(44)39-28(18-22-19-37-26-9-5-4-8-24(22)26)33(45)40-29(34(46)47)17-21-10-12-23(41)13-11-21/h1-13,19,25,27-29,37,41H,14-18,35H2,(H2,36,42)(H,38,43)(H,39,44)(H,40,45)(H,46,47)/t25-,27-,28-,29-/m0/s1 |
| InChIKey | UNAMJIYDGRQWFH-AMEOFWRWSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gln-Phe-Trp-Tyr (CHEBI:73464) has functional parent L-glutamine (CHEBI:18050) |
| Gln-Phe-Trp-Tyr (CHEBI:73464) has functional parent L-phenylalanine (CHEBI:17295) |
| Gln-Phe-Trp-Tyr (CHEBI:73464) has functional parent L-tryptophan (CHEBI:16828) |
| Gln-Phe-Trp-Tyr (CHEBI:73464) has functional parent L-tyrosine (CHEBI:17895) |
| Gln-Phe-Trp-Tyr (CHEBI:73464) has role metabolite (CHEBI:25212) |
| Gln-Phe-Trp-Tyr (CHEBI:73464) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-glutaminyl-L-phenylalanyl-L-tryptophyl-L-tyrosine |
| Synonyms | Source |
|---|---|
| Q-F-W-Y | ChEBI |
| QFWY | ChEBI |
| L-Gln-L-Phe-L-Trp-L-Tyr | ChEBI |