EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H39N5O6 |
| Net Charge | 0 |
| Average Mass | 469.583 |
| Monoisotopic Mass | 469.29003 |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](N)CCC(N)=O)C(=O)N[C@@H](CC(C)C)C(=O)N1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C22H39N5O6/c1-12(2)10-15(25-19(29)14(23)7-8-18(24)28)20(30)26-16(11-13(3)4)21(31)27-9-5-6-17(27)22(32)33/h12-17H,5-11,23H2,1-4H3,(H2,24,28)(H,25,29)(H,26,30)(H,32,33)/t14-,15-,16-,17-/m0/s1 |
| InChIKey | OAOOXBSVCJEIFY-QAETUUGQSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Gln-Leu-Leu-Pro (CHEBI:73463) has functional parent L-glutamine (CHEBI:18050) |
| Gln-Leu-Leu-Pro (CHEBI:73463) has functional parent L-leucine (CHEBI:15603) |
| Gln-Leu-Leu-Pro (CHEBI:73463) has functional parent L-proline (CHEBI:17203) |
| Gln-Leu-Leu-Pro (CHEBI:73463) has role metabolite (CHEBI:25212) |
| Gln-Leu-Leu-Pro (CHEBI:73463) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| L-glutaminyl-L-leucyl-L-leucyl-L-proline |
| Synonyms | Source |
|---|---|
| L-Gln-L-Leu-L-Leu-L-Pro | ChEBI |
| Q-L-L-P | ChEBI |
| QLLP | ChEBI |